Problem: Write the chemical equation for the reaction of propylamine, C3H7NH2 with water.Write the Kb expression for the reaction of propylamine, C3H7NH2 with water.a) [C3H7NH+3][OH−][C3H7NH2]b) [C3H7NH2][H2O][C3H7NH+3][OH−]c) [C3H7NH2][C3H7NH+3][OH−]d) [C3H7NH+3][OH−][C3H7NH2][H2O]

FREE Expert Solution

weak base:

B (aq) + H2O (l) HB+ (aq) + OH- (aq)


Kb expression

Kb = productsreactants


View Complete Written Solution
Problem Details

Write the chemical equation for the reaction of propylamine, C3H7NH2 with water.

Write the Kb expression for the reaction of propylamine, C3H7NH2 with water.

a) [C3H7NH+3][OH−][C3H7NH2]

b) [C3H7NH2][H2O][C3H7NH+3][OH]

c) [C3H7NH2][C3H7NH+3][OH]

d) [C3H7NH+3][OH][C3H7NH2][H2O]