Chemistry Practice Problems Equilibrium Expressions Practice Problems Solution: What is the expression for Kp for the reaction bel...

Solution: What is the expression for Kp for the reaction below? 4CuO (s) + CH4 (g) ⇌ CO2 (g) + 4Cu (s) + 2H2O (g). a. Kp = [CuO]4[CH4][CO2][Cu]4[H2O]2b. Kp = [CH4][CO2][H2O]2c. Kp = [CO2][Cu]4[H2O]2[CuO]4[CH4]d. Kp = [CO2][H2O]2[CH4] e. Kp = [CO2][H2O][CH4] 

Problem

What is the expression for Kp for the reaction below? 4CuO (s) + CH4 (g) ⇌ CO2 (g) + 4Cu (s) + 2H2O (g)

. a. Kp = [CuO]4[CH4][CO2][Cu]4[H2O]2b. Kp = [CH4][CO2][H2O]2c. Kp = [CO2][Cu]4[H2O]2[CuO]4[CH4]d. Kp = [CO2][H2O]2[CH4] e. Kp = [CO2][H2O][CH4] 


Solution

Setup the Kp expression for the reaction and determine which is the correct one for the reaction:

4CuO (s) + CH4 (g) ⇌ CO2 (g) + 4Cu (s) + 2H2O (g)

Kp is the equilibrium expression of the concentrations in the reaction. The general form of an equilibrium expression is:

Solution BlurView Complete Written Solution